C17H20ClNO5 — CID 2961140
N-[4-(4-chlorophenoxy)but-2-ynyl]cyclopentanamine;oxalic acid (PubChem CID 2961140) has the molecular formula C17H20ClNO5 and a molecular weight of 353.80 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)but-2-ynyl]cyclopentanamine;oxalic acid.
| Compound Name | N-[4-(4-chlorophenoxy)but-2-ynyl]cyclopentanamine;oxalic acid |
|---|---|
| PubChem CID | 2961140 |
| Molecular Formula | C17H20ClNO5 |
| Molecular Weight | 353.80 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[4-(4-chlorophenoxy)but-2-ynyl]cyclopentanamine;oxalic acid |
| SMILES | Clc1ccc(OCC#CCNC2CCCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H18ClNO.C2H2O4/c16-13-7-9-15(10-8-13)18-12-4-3-11-17-14-5-1-2-6-14;3-1(4)2(5)6/h7-10,14,17H,1-2,5-6,11-12H2;(H,3,4)(H,5,6) |
| InChIKey | YCHPZQMMXGLABV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|