C15H18ClNO6 — CID 2961674
4-(4-chlorophenoxy)-N-(2-methoxyethyl)but-2-yn-1-amine;oxalic acid (PubChem CID 2961674) has the molecular formula C15H18ClNO6 and a molecular weight of 343.76 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(2-methoxyethyl)but-2-yn-1-amine;oxalic acid.
| Compound Name | 4-(4-chlorophenoxy)-N-(2-methoxyethyl)but-2-yn-1-amine;oxalic acid |
|---|---|
| PubChem CID | 2961674 |
| Molecular Formula | C15H18ClNO6 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(2-methoxyethyl)but-2-yn-1-amine;oxalic acid |
| SMILES | COCCNCC#CCOc1ccc(Cl)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H16ClNO2.C2H2O4/c1-16-11-9-15-8-2-3-10-17-13-6-4-12(14)5-7-13;3-1(4)2(5)6/h4-7,15H,8-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KUGFCLOEDACLPP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|