C20H31NO5 — CID 2948780
N-[3-(4-tert-butylphenoxy)propyl]cyclopentanamine;oxalic acid (PubChem CID 2948780) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is N-[3-(4-tert-butylphenoxy)propyl]cyclopentanamine;oxalic acid.
| Compound Name | N-[3-(4-tert-butylphenoxy)propyl]cyclopentanamine;oxalic acid |
|---|---|
| PubChem CID | 2948780 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[3-(4-tert-butylphenoxy)propyl]cyclopentanamine;oxalic acid |
| SMILES | CC(C)(C)c1ccc(OCCCNC2CCCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H29NO.C2H2O4/c1-18(2,3)15-9-11-17(12-10-15)20-14-6-13-19-16-7-4-5-8-16;3-1(4)2(5)6/h9-12,16,19H,4-8,13-14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ZZQDKJZVUPYFTJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|