C16H19NO5S — CID 70215750
cis-(1S,2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]cyclopentane-1-carboxylic acid (PubChem CID 70215750) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 70215750 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | cis-(1S,2R)-2-[(4-but-2-ynoxyphenyl)sulfonylamino]cyclopentane-1-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N[C@@H]2CCC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C16H19NO5S/c1-2-3-11-22-12-7-9-13(10-8-12)23(20,21)17-15-6-4-5-14(15)16(18)19/h7-10,14-15,17H,4-6,11H2,1H3,(H,18,19)/t14-,15+/m0/s1 |
| InChIKey | YKDYEVHQQXFLQF-LSDHHAIUSA-N |
| XLogP | 1.62 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|