C15H18O3S2 — CID 25138255
3-(4-but-2-ynoxyphenyl)sulfonylcyclopentane-1-thiol (PubChem CID 25138255) has the molecular formula C15H18O3S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(4-but-2-ynoxyphenyl)sulfonylcyclopentane-1-thiol.
| Compound Name | 3-(4-but-2-ynoxyphenyl)sulfonylcyclopentane-1-thiol |
|---|---|
| PubChem CID | 25138255 |
| Molecular Formula | C15H18O3S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-(4-but-2-ynoxyphenyl)sulfonylcyclopentane-1-thiol |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2CCC(S)C2)cc1 |
| InChI | InChI=1S/C15H18O3S2/c1-2-3-10-18-12-4-7-14(8-5-12)20(16,17)15-9-6-13(19)11-15/h4-5,7-8,13,15,19H,6,9-11H2,1H3 |
| InChIKey | MGTOBLJTRIDRIH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|