C23H26F3N3O7S — CID 11226558
N-hydroxy-2-(4-pyridin-4-yloxyphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 11226558) has the molecular formula C23H26F3N3O7S and a molecular weight of 545.54 g/mol. Its IUPAC name is N-hydroxy-2-(4-pyridin-4-yloxyphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2-(4-pyridin-4-yloxyphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11226558 |
| Molecular Formula | C23H26F3N3O7S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | N-hydroxy-2-(4-pyridin-4-yloxyphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)C1C2CCCCC2CCN1S(=O)(=O)c1ccc(Oc2ccncc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H25N3O5S.C2HF3O2/c25-21(23-26)20-19-4-2-1-3-15(19)11-14-24(20)30(27,28)18-7-5-16(6-8-18)29-17-9-12-22-13-10-17;3-2(4,5)1(6)7/h5-10,12-13,15,19-20,26H,1-4,11,14H2,(H,23,25);(H,6,7) |
| InChIKey | PYWWYWCVINBAQB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|