C21H25N3O7S2 — CID 143262973
(3aR,4R,7aS)-5-[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-4-carbohydrazide (PubChem CID 143262973) has the molecular formula C21H25N3O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is (3aR,4R,7aS)-5-[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-4-carbohydrazide.
| Compound Name | (3aR,4R,7aS)-5-[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 143262973 |
| Molecular Formula | C21H25N3O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (3aR,4R,7aS)-5-[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-4-carbohydrazide |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)N3CC[C@@H]4OCC[C@@H]4[C@@H]3C(=O)NN)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O7S2/c1-32(26,27)16-6-2-14(3-7-16)31-15-4-8-17(9-5-15)33(28,29)24-12-10-19-18(11-13-30-19)20(24)21(25)23-22/h2-9,18-20H,10-13,22H2,1H3,(H,23,25)/t18-,19-,20+/m0/s1 |
| InChIKey | TWBLIRUALFKPRW-SLFFLAALSA-N |
| XLogP | 1.04 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|