C18H21N3O7S2 — CID 22901521
[(2R)-4-methylsulfonyl-1-(4-phenoxyphenyl)sulfonylpiperazin-2-yl] carbamate (PubChem CID 22901521) has the molecular formula C18H21N3O7S2 and a molecular weight of 455.51 g/mol. Its IUPAC name is [(2R)-4-methylsulfonyl-1-(4-phenoxyphenyl)sulfonylpiperazin-2-yl] carbamate.
| Compound Name | [(2R)-4-methylsulfonyl-1-(4-phenoxyphenyl)sulfonylpiperazin-2-yl] carbamate |
|---|---|
| PubChem CID | 22901521 |
| Molecular Formula | C18H21N3O7S2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | [(2R)-4-methylsulfonyl-1-(4-phenoxyphenyl)sulfonylpiperazin-2-yl] carbamate |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)[C@H](OC(N)=O)C1 |
| InChI | InChI=1S/C18H21N3O7S2/c1-29(23,24)20-11-12-21(17(13-20)28-18(19)22)30(25,26)16-9-7-15(8-10-16)27-14-5-3-2-4-6-14/h2-10,17H,11-13H2,1H3,(H2,19,22)/t17-/m1/s1 |
| InChIKey | MDFMJWGUOQREJJ-QGZVFWFLSA-N |
| XLogP | 1.17 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |