C22H25ClN2O4S — CID 11166804
(1S,4aR,8aR)-2-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide (PubChem CID 11166804) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is (1S,4aR,8aR)-2-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide.
| Compound Name | (1S,4aR,8aR)-2-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 11166804 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (1S,4aR,8aR)-2-[4-(4-chlorophenyl)phenyl]sulfonyl-N-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-1-carboxamide |
| SMILES | O=C(NO)[C@@H]1[C@@H]2CCCC[C@@H]2CCN1S(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H25ClN2O4S/c23-18-9-5-15(6-10-18)16-7-11-19(12-8-16)30(28,29)25-14-13-17-3-1-2-4-20(17)21(25)22(26)24-27/h5-12,17,20-21,27H,1-4,13-14H2,(H,24,26)/t17-,20-,21+/m1/s1 |
| InChIKey | XYJZQBRDTPRLDB-UIFIKXQLSA-N |
| XLogP | 4.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|