C10H12ClN3O3S2 — CID 6930227
(2S)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine-2-carbohydrazide (PubChem CID 6930227) has the molecular formula C10H12ClN3O3S2 and a molecular weight of 321.81 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine-2-carbohydrazide.
| Compound Name | (2S)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 6930227 |
| Molecular Formula | C10H12ClN3O3S2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1SCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClN3O3S2/c11-7-1-3-8(4-2-7)19(16,17)14-5-6-18-10(14)9(15)13-12/h1-4,10H,5-6,12H2,(H,13,15)/t10-/m0/s1 |
| InChIKey | QSEDNOKNZJUECI-JTQLQIEISA-N |
| XLogP | 0.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|