C28H26ClN3O3S2 — CID 167695455
N-[(6-chloro-3-pyridinyl)-phenylmethyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide;molecular hydrogen (PubChem CID 167695455) has the molecular formula C28H26ClN3O3S2 and a molecular weight of 552.12 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)-phenylmethyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide;molecular hydrogen.
| Compound Name | N-[(6-chloro-3-pyridinyl)-phenylmethyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 167695455 |
| Molecular Formula | C28H26ClN3O3S2 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)-phenylmethyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide;molecular hydrogen |
| SMILES | O=C(NC(c1ccccc1)c1ccc(Cl)nc1)C1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1.[H][H] |
| InChI | InChI=1S/C28H24ClN3O3S2.H2/c29-25-16-13-23(19-30-25)26(22-9-5-2-6-10-22)31-27(33)28-32(17-18-36-28)37(34,35)24-14-11-21(12-15-24)20-7-3-1-4-8-20;/h1-16,19,26,28H,17-18H2,(H,31,33);1H |
| InChIKey | XOWUGJBWZNOLMR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|