C33H35N3O3S2 — CID 10289920
N-[1-phenyl-3-(2-phenylethylamino)propyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide (PubChem CID 10289920) has the molecular formula C33H35N3O3S2 and a molecular weight of 585.80 g/mol. Its IUPAC name is N-[1-phenyl-3-(2-phenylethylamino)propyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide.
| Compound Name | N-[1-phenyl-3-(2-phenylethylamino)propyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 10289920 |
| Molecular Formula | C33H35N3O3S2 |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | N-[1-phenyl-3-(2-phenylethylamino)propyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(NC(CCNCCc1ccccc1)c1ccccc1)C1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H35N3O3S2/c37-32(35-31(29-14-8-3-9-15-29)21-23-34-22-20-26-10-4-1-5-11-26)33-36(24-25-40-33)41(38,39)30-18-16-28(17-19-30)27-12-6-2-7-13-27/h1-19,31,33-34H,20-25H2,(H,35,37) |
| InChIKey | QYKJIRWDHJUYQI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|