C30H35N3O4S2 — CID 68621901
N-[3-[[(2S)-oxolan-2-yl]methylamino]-1-phenylpropyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide (PubChem CID 68621901) has the molecular formula C30H35N3O4S2 and a molecular weight of 565.76 g/mol. Its IUPAC name is N-[3-[[(2S)-oxolan-2-yl]methylamino]-1-phenylpropyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide.
| Compound Name | N-[3-[[(2S)-oxolan-2-yl]methylamino]-1-phenylpropyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 68621901 |
| Molecular Formula | C30H35N3O4S2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | N-[3-[[(2S)-oxolan-2-yl]methylamino]-1-phenylpropyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(NC(CCNC[C@@H]1CCCO1)c1ccccc1)C1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N3O4S2/c34-29(32-28(25-10-5-2-6-11-25)17-18-31-22-26-12-7-20-37-26)30-33(19-21-38-30)39(35,36)27-15-13-24(14-16-27)23-8-3-1-4-9-23/h1-6,8-11,13-16,26,28,30-31H,7,12,17-22H2,(H,32,34)/t26-,28?,30?/m0/s1 |
| InChIKey | VXELDQDIAIXCGX-SNKUFMAISA-N |
| XLogP | 4.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|