C25H24N2O4S2 — CID 167544763
4-oxo-2-phenyl-4-[3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]butanamide (PubChem CID 167544763) has the molecular formula C25H24N2O4S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 4-oxo-2-phenyl-4-[3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]butanamide.
| Compound Name | 4-oxo-2-phenyl-4-[3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]butanamide |
|---|---|
| PubChem CID | 167544763 |
| Molecular Formula | C25H24N2O4S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-oxo-2-phenyl-4-[3-(4-phenylphenyl)sulfonyl-1,3-thiazolidin-2-yl]butanamide |
| SMILES | NC(=O)C(CC(=O)C1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O4S2/c26-24(29)22(20-9-5-2-6-10-20)17-23(28)25-27(15-16-32-25)33(30,31)21-13-11-19(12-14-21)18-7-3-1-4-8-18/h1-14,22,25H,15-17H2,(H2,26,29) |
| InChIKey | BQJQAPVHYZOQIJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |