C29H29N3O3S2 — CID 88999303
(2S)-N-[(1R,2Z,4Z)-2-(methylideneamino)-1-phenylhexa-2,4-dienyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide (PubChem CID 88999303) has the molecular formula C29H29N3O3S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is (2S)-N-[(1R,2Z,4Z)-2-(methylideneamino)-1-phenylhexa-2,4-dienyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1R,2Z,4Z)-2-(methylideneamino)-1-phenylhexa-2,4-dienyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 88999303 |
| Molecular Formula | C29H29N3O3S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (2S)-N-[(1R,2Z,4Z)-2-(methylideneamino)-1-phenylhexa-2,4-dienyl]-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine-2-carboxamide |
| SMILES | C=N/C(=C\C=C/C)[C@H](NC(=O)[C@@H]1SCCN1S(=O)(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O3S2/c1-3-4-15-26(30-2)27(24-13-9-6-10-14-24)31-28(33)29-32(20-21-36-29)37(34,35)25-18-16-23(17-19-25)22-11-7-5-8-12-22/h3-19,27,29H,2,20-21H2,1H3,(H,31,33)/b4-3-,26-15-/t27-,29+/m1/s1 |
| InChIKey | DTFKULKBQJIFIK-UQDPTLIQSA-N |
| XLogP | 5.44 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|