C22H20IN3O3S2 — CID 57462303
(2S)-3-(4-iodophenyl)sulfonyl-N-[phenyl(pyridin-2-yl)methyl]-1,3-thiazolidine-2-carboxamide (PubChem CID 57462303) has the molecular formula C22H20IN3O3S2 and a molecular weight of 565.46 g/mol. Its IUPAC name is (2S)-3-(4-iodophenyl)sulfonyl-N-[phenyl(pyridin-2-yl)methyl]-1,3-thiazolidine-2-carboxamide.
| Compound Name | (2S)-3-(4-iodophenyl)sulfonyl-N-[phenyl(pyridin-2-yl)methyl]-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 57462303 |
| Molecular Formula | C22H20IN3O3S2 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | (2S)-3-(4-iodophenyl)sulfonyl-N-[phenyl(pyridin-2-yl)methyl]-1,3-thiazolidine-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccn1)[C@@H]1SCCN1S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C22H20IN3O3S2/c23-17-9-11-18(12-10-17)31(28,29)26-14-15-30-22(26)21(27)25-20(16-6-2-1-3-7-16)19-8-4-5-13-24-19/h1-13,20,22H,14-15H2,(H,25,27)/t20?,22-/m0/s1 |
| InChIKey | DPNGHXILFFWKIP-IAXKEJLGSA-N |
| XLogP | 3.66 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|