C17H17ClN2O3S2 — CID 654431
N-[4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]acetamide (PubChem CID 654431) has the molecular formula C17H17ClN2O3S2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-[4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 654431 |
| Molecular Formula | C17H17ClN2O3S2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-[4-[[2-(4-chlorophenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCSC2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H17ClN2O3S2/c1-12(21)19-15-6-8-16(9-7-15)25(22,23)20-10-11-24-17(20)13-2-4-14(18)5-3-13/h2-9,17H,10-11H2,1H3,(H,19,21) |
| InChIKey | OKYLPGGTLCEBKE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |