C21H26N4O7S — CID 57199102
methyl N-[(2R,3S)-2-(hydroxycarbamoyl)-1-[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylpiperidin-3-yl]carbamate (PubChem CID 57199102) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is methyl N-[(2R,3S)-2-(hydroxycarbamoyl)-1-[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylpiperidin-3-yl]carbamate.
| Compound Name | methyl N-[(2R,3S)-2-(hydroxycarbamoyl)-1-[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 57199102 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | methyl N-[(2R,3S)-2-(hydroxycarbamoyl)-1-[4-(2-pyridin-4-ylethoxy)phenyl]sulfonylpiperidin-3-yl]carbamate |
| SMILES | COC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccc(OCCc3ccncc3)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C21H26N4O7S/c1-31-21(27)23-18-3-2-13-25(19(18)20(26)24-28)33(29,30)17-6-4-16(5-7-17)32-14-10-15-8-11-22-12-9-15/h4-9,11-12,18-19,28H,2-3,10,13-14H2,1H3,(H,23,27)(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | AIOQHOPGAMSODJ-RBUKOAKNSA-N |
| XLogP | 1.09 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|