C17H20N2O4S — CID 124799679
(2R,3R)-1-(4-methoxyphenyl)sulfonyl-2-(pyridin-4-ylmethyl)pyrrolidin-3-ol (PubChem CID 124799679) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is (2R,3R)-1-(4-methoxyphenyl)sulfonyl-2-(pyridin-4-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (2R,3R)-1-(4-methoxyphenyl)sulfonyl-2-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 124799679 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R,3R)-1-(4-methoxyphenyl)sulfonyl-2-(pyridin-4-ylmethyl)pyrrolidin-3-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H](O)[C@H]2Cc2ccncc2)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-23-14-2-4-15(5-3-14)24(21,22)19-11-8-17(20)16(19)12-13-6-9-18-10-7-13/h2-7,9-10,16-17,20H,8,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | QTUKKBZJVQMRRZ-IAGOWNOFSA-N |
| XLogP | 1.46 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |