C20H20N4O6S — CID 18345613
(3R)-N-hydroxy-4-[4-[4-(1H-imidazol-2-yl)phenoxy]phenyl]sulfonylmorpholine-3-carboxamide (PubChem CID 18345613) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is (3R)-N-hydroxy-4-[4-[4-(1H-imidazol-2-yl)phenoxy]phenyl]sulfonylmorpholine-3-carboxamide.
| Compound Name | (3R)-N-hydroxy-4-[4-[4-(1H-imidazol-2-yl)phenoxy]phenyl]sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 18345613 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (3R)-N-hydroxy-4-[4-[4-(1H-imidazol-2-yl)phenoxy]phenyl]sulfonylmorpholine-3-carboxamide |
| SMILES | O=C(NO)[C@H]1COCCN1S(=O)(=O)c1ccc(Oc2ccc(-c3ncc[nH]3)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O6S/c25-20(23-26)18-13-29-12-11-24(18)31(27,28)17-7-5-16(6-8-17)30-15-3-1-14(2-4-15)19-21-9-10-22-19/h1-10,18,26H,11-13H2,(H,21,22)(H,23,25)/t18-/m1/s1 |
| InChIKey | BZXLSGYZOWXWMK-GOSISDBHSA-N |
| XLogP | 1.76 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|