C11H13FN2O4S — CID 71193250
(3R)-4-(4-fluorophenyl)sulfonylmorpholine-3-carboxamide (PubChem CID 71193250) has the molecular formula C11H13FN2O4S and a molecular weight of 288.30 g/mol. Its IUPAC name is (3R)-4-(4-fluorophenyl)sulfonylmorpholine-3-carboxamide.
| Compound Name | (3R)-4-(4-fluorophenyl)sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 71193250 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (3R)-4-(4-fluorophenyl)sulfonylmorpholine-3-carboxamide |
| SMILES | NC(=O)[C@H]1COCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN2O4S/c12-8-1-3-9(4-2-8)19(16,17)14-5-6-18-7-10(14)11(13)15/h1-4,10H,5-7H2,(H2,13,15)/t10-/m1/s1 |
| InChIKey | NCDSIFNHZHELSA-SNVBAGLBSA-N |
| XLogP | -0.30 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |