C11H12BrFN2O4S — CID 83092795
4-(2-bromo-4-fluorophenyl)sulfonylmorpholine-3-carboxamide (PubChem CID 83092795) has the molecular formula C11H12BrFN2O4S and a molecular weight of 367.20 g/mol. Its IUPAC name is 4-(2-bromo-4-fluorophenyl)sulfonylmorpholine-3-carboxamide.
| Compound Name | 4-(2-bromo-4-fluorophenyl)sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83092795 |
| Molecular Formula | C11H12BrFN2O4S |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 4-(2-bromo-4-fluorophenyl)sulfonylmorpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1S(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H12BrFN2O4S/c12-8-5-7(13)1-2-10(8)20(17,18)15-3-4-19-6-9(15)11(14)16/h1-2,5,9H,3-4,6H2,(H2,14,16) |
| InChIKey | DJJGXUJUPOJPGW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |