C11H15BrN2O3S — CID 93111095
3-bromo-4-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline (PubChem CID 93111095) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 3-bromo-4-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline.
| Compound Name | 3-bromo-4-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline |
|---|---|
| PubChem CID | 93111095 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 3-bromo-4-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline |
| SMILES | C[C@@H]1COCCN1S(=O)(=O)c1ccc(N)cc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c1-8-7-17-5-4-14(8)18(15,16)11-3-2-9(13)6-10(11)12/h2-3,6,8H,4-5,7,13H2,1H3/t8-/m1/s1 |
| InChIKey | KAWDXTGRLKSHAZ-MRVPVSSYSA-N |
| XLogP | 1.44 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|