C14H22N2O3S — CID 106773727
2,4,6-trimethyl-3-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline (PubChem CID 106773727) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline.
| Compound Name | 2,4,6-trimethyl-3-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline |
|---|---|
| PubChem CID | 106773727 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2,4,6-trimethyl-3-[(3R)-3-methylmorpholin-4-yl]sulfonylaniline |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCOC[C@H]2C)c(C)c1N |
| InChI | InChI=1S/C14H22N2O3S/c1-9-7-10(2)14(12(4)13(9)15)20(17,18)16-5-6-19-8-11(16)3/h7,11H,5-6,8,15H2,1-4H3/t11-/m1/s1 |
| InChIKey | IJLWXEQQEXFQBX-LLVKDONJSA-N |
| XLogP | 1.60 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|