C13H18FNO3S — CID 107326726
4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylmorpholine (PubChem CID 107326726) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylmorpholine.
| Compound Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylmorpholine |
|---|---|
| PubChem CID | 107326726 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylmorpholine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOCC1C |
| InChI | InChI=1S/C13H18FNO3S/c1-9-6-12(14)7-10(2)13(9)19(16,17)15-4-5-18-8-11(15)3/h6-7,11H,4-5,8H2,1-3H3 |
| InChIKey | HJRCVSXEQMWYBV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |