About 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine
4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine (PubChem CID 107327705) has the molecular formula C13H15FN2O4S
and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine.
Molecular Properties
| Compound Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine |
| PubChem CID | 107327705 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOCC1N=C=O |
| InChI | InChI=1S/C13H15FN2O4S/c1-9-5-11(14)6-10(2)13(9)21(18,19)16-3-4-20-7-12(16)15-8-17/h5-6,12H,3-4,7H2,1-2H3 |
| InChIKey | GKGLKFHBEFRUJC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine?
The IUPAC name of 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine (CID 107327705) is 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine.
What is the SMILES notation for 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine?
The canonical SMILES for 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine is Cc1cc(F)cc(C)c1S(=O)(=O)N1CCOCC1N=C=O.
What is the InChIKey of 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine?
The InChIKey is GKGLKFHBEFRUJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O4S/c1-9-5-11(14)6-10(2)13(9)21(18,19)16-3-4-20-7-12(16)15-8-17/h5-6,12H,3-4,7H2,1-2H3.
What are the key properties of 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine?
4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine has a molecular weight of 314.34 g/mol, XLogP of 1.13, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-2,6-dimethylphenyl)sulfonyl-3-isocyanatomorpholine is sourced from PubChem (CID 107327705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).