C16H23NO4S — CID 136529774
1-[4-(2,4,6-trimethylphenyl)sulfonylmorpholin-3-yl]propan-2-one (PubChem CID 136529774) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-[4-(2,4,6-trimethylphenyl)sulfonylmorpholin-3-yl]propan-2-one.
| Compound Name | 1-[4-(2,4,6-trimethylphenyl)sulfonylmorpholin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 136529774 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[4-(2,4,6-trimethylphenyl)sulfonylmorpholin-3-yl]propan-2-one |
| SMILES | CC(=O)CC1COCCN1S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H23NO4S/c1-11-7-12(2)16(13(3)8-11)22(19,20)17-5-6-21-10-15(17)9-14(4)18/h7-8,15H,5-6,9-10H2,1-4H3 |
| InChIKey | JUHSUQCSXRNUJG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |