C16H23NO7S — CID 87550329
[(3S)-4-(4-methoxy-2,6-dimethylphenyl)sulfonylmorpholin-3-yl]methyl ethaneperoxoate (PubChem CID 87550329) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is [(3S)-4-(4-methoxy-2,6-dimethylphenyl)sulfonylmorpholin-3-yl]methyl ethaneperoxoate.
| Compound Name | [(3S)-4-(4-methoxy-2,6-dimethylphenyl)sulfonylmorpholin-3-yl]methyl ethaneperoxoate |
|---|---|
| PubChem CID | 87550329 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [(3S)-4-(4-methoxy-2,6-dimethylphenyl)sulfonylmorpholin-3-yl]methyl ethaneperoxoate |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCOC[C@H]2COOC(C)=O)c(C)c1 |
| InChI | InChI=1S/C16H23NO7S/c1-11-7-15(21-4)8-12(2)16(11)25(19,20)17-5-6-22-9-14(17)10-23-24-13(3)18/h7-8,14H,5-6,9-10H2,1-4H3/t14-/m0/s1 |
| InChIKey | IVEYHHFRCQPTEZ-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|