C32H46N2O7S2 — CID 68644209
1,4-bis[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]butan-1-one (PubChem CID 68644209) has the molecular formula C32H46N2O7S2 and a molecular weight of 634.86 g/mol. Its IUPAC name is 1,4-bis[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]butan-1-one.
| Compound Name | 1,4-bis[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 68644209 |
| Molecular Formula | C32H46N2O7S2 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 1,4-bis[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]butan-1-one |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCCC2CCCC(=O)C2CCCCN2S(=O)(=O)c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C32H46N2O7S2/c1-22-18-27(40-5)19-23(2)31(22)42(36,37)33-16-9-7-12-26(33)13-11-15-30(35)29-14-8-10-17-34(29)43(38,39)32-24(3)20-28(41-6)21-25(32)4/h18-21,26,29H,7-17H2,1-6H3 |
| InChIKey | QWJBFNFSLIKZCF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |