C17H23NO5S — CID 66754987
(E)-3-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]prop-2-enoic acid (PubChem CID 66754987) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is (E)-3-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66754987 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (E)-3-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]prop-2-enoic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCCC2/C=C/C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H23NO5S/c1-12-10-15(23-3)11-13(2)17(12)24(21,22)18-9-5-4-6-14(18)7-8-16(19)20/h7-8,10-11,14H,4-6,9H2,1-3H3,(H,19,20)/b8-7+ |
| InChIKey | PRYKXHXGUCVNTD-BQYQJAHWSA-N |
| XLogP | 2.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|