C18H22N2O3S — CID 110871730
2-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]pyridine (PubChem CID 110871730) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 110871730 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpyrrolidin-2-yl]pyridine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCC2c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13-11-15(23-3)12-14(2)18(13)24(21,22)20-10-6-8-17(20)16-7-4-5-9-19-16/h4-5,7,9,11-12,17H,6,8,10H2,1-3H3 |
| InChIKey | LLSKFGBWFKBQPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |