C14H21NO3S — CID 110728257
1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2-methylpyrrolidine (PubChem CID 110728257) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2-methylpyrrolidine.
| Compound Name | 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2-methylpyrrolidine |
|---|---|
| PubChem CID | 110728257 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2-methylpyrrolidine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCC2C)c(C)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-10-8-13(18-4)9-11(2)14(10)19(16,17)15-7-5-6-12(15)3/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | KGTHSSJOGDTMEE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |