About 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine
1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine (PubChem CID 64979833) has the molecular formula C15H24N2O3S
and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine |
| PubChem CID | 64979833 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CC(C)NCC2C)c(C)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-10-6-14(20-5)7-11(2)15(10)21(18,19)17-9-12(3)16-8-13(17)4/h6-7,12-13,16H,8-9H2,1-5H3 |
| InChIKey | YMHFNSARQITMEU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine?
The IUPAC name of 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine (CID 64979833) is 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine.
What is the SMILES notation for 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine?
The canonical SMILES for 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine is COc1cc(C)c(S(=O)(=O)N2CC(C)NCC2C)c(C)c1.
What is the InChIKey of 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine?
The InChIKey is YMHFNSARQITMEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3S/c1-10-6-14(20-5)7-11(2)15(10)21(18,19)17-9-12(3)16-8-13(17)4/h6-7,12-13,16H,8-9H2,1-5H3.
What are the key properties of 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine?
1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine has a molecular weight of 312.44 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxy-2,6-dimethylphenyl)sulfonyl-2,5-dimethylpiperazine is sourced from PubChem (CID 64979833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).