C14H22N2O2S — CID 82756064
(2S)-2-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperazine (PubChem CID 82756064) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is (2S)-2-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperazine.
| Compound Name | (2S)-2-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 82756064 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2S)-2-methyl-1-(2,4,6-trimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCNC[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C14H22N2O2S/c1-10-7-11(2)14(12(3)8-10)19(17,18)16-6-5-15-9-13(16)4/h7-8,13,15H,5-6,9H2,1-4H3/t13-/m0/s1 |
| InChIKey | NXRAGURCFYEPJU-ZDUSSCGKSA-N |
| XLogP | 1.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |