C14H22N2O4S2 — CID 120716863
(2R)-1-(2,5-dimethyl-3-methylsulfonylphenyl)sulfonyl-2-methylpiperazine (PubChem CID 120716863) has the molecular formula C14H22N2O4S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R)-1-(2,5-dimethyl-3-methylsulfonylphenyl)sulfonyl-2-methylpiperazine.
| Compound Name | (2R)-1-(2,5-dimethyl-3-methylsulfonylphenyl)sulfonyl-2-methylpiperazine |
|---|---|
| PubChem CID | 120716863 |
| Molecular Formula | C14H22N2O4S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2R)-1-(2,5-dimethyl-3-methylsulfonylphenyl)sulfonyl-2-methylpiperazine |
| SMILES | Cc1cc(S(C)(=O)=O)c(C)c(S(=O)(=O)N2CCNC[C@H]2C)c1 |
| InChI | InChI=1S/C14H22N2O4S2/c1-10-7-13(21(4,17)18)12(3)14(8-10)22(19,20)16-6-5-15-9-11(16)2/h7-8,11,15H,5-6,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | XWULREQGJHAUNJ-LLVKDONJSA-N |
| XLogP | 0.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |