C16H24N2O3S — CID 110708600
1-cyclopropyl-4-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperazine (PubChem CID 110708600) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-cyclopropyl-4-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-cyclopropyl-4-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110708600 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-cyclopropyl-4-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperazine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCN(C3CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C16H24N2O3S/c1-12-10-15(21-3)11-13(2)16(12)22(19,20)18-8-6-17(7-9-18)14-4-5-14/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | ZESNGSHIDGKNQU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |