C21H33NO6S — CID 90986622
butyl 2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]acetate (PubChem CID 90986622) has the molecular formula C21H33NO6S and a molecular weight of 427.56 g/mol. Its IUPAC name is butyl 2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]acetate.
| Compound Name | butyl 2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 90986622 |
| Molecular Formula | C21H33NO6S |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | butyl 2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]acetate |
| SMILES | CCCCOC(=O)COCC1CCCCN1S(=O)(=O)c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C21H33NO6S/c1-5-6-11-28-20(23)15-27-14-18-9-7-8-10-22(18)29(24,25)21-16(2)12-19(26-4)13-17(21)3/h12-13,18H,5-11,14-15H2,1-4H3 |
| InChIKey | WYRLYOJOZVEQGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|