C29H43N3O5S — CID 67454704
N-[[4-(dimethylamino)phenyl]methyl]-2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]-N-propan-2-ylacetamide (PubChem CID 67454704) has the molecular formula C29H43N3O5S and a molecular weight of 545.75 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]-N-propan-2-ylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 67454704 |
| Molecular Formula | C29H43N3O5S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[1-(4-methoxy-2,6-dimethylphenyl)sulfonylpiperidin-2-yl]methoxy]-N-propan-2-ylacetamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCCCC2COCC(=O)N(Cc2ccc(N(C)C)cc2)C(C)C)c(C)c1 |
| InChI | InChI=1S/C29H43N3O5S/c1-21(2)31(18-24-11-13-25(14-12-24)30(5)6)28(33)20-37-19-26-10-8-9-15-32(26)38(34,35)29-22(3)16-27(36-7)17-23(29)4/h11-14,16-17,21,26H,8-10,15,18-20H2,1-7H3 |
| InChIKey | IQRUMRHEXSKAHM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|