C15H24N2O5S — CID 120874755
[1-(2,4,6-trimethoxyphenyl)sulfonylpiperidin-2-yl]methanamine (PubChem CID 120874755) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is [1-(2,4,6-trimethoxyphenyl)sulfonylpiperidin-2-yl]methanamine.
| Compound Name | [1-(2,4,6-trimethoxyphenyl)sulfonylpiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 120874755 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [1-(2,4,6-trimethoxyphenyl)sulfonylpiperidin-2-yl]methanamine |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2CCCCC2CN)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-20-12-8-13(21-2)15(14(9-12)22-3)23(18,19)17-7-5-4-6-11(17)10-16/h8-9,11H,4-7,10,16H2,1-3H3 |
| InChIKey | RAIGIXFGAPIZJS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |