C15H22N2O5S — CID 120707972
methyl 4-[2-(aminomethyl)piperidin-1-yl]sulfonyl-3-methoxybenzoate (PubChem CID 120707972) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 4-[2-(aminomethyl)piperidin-1-yl]sulfonyl-3-methoxybenzoate.
| Compound Name | methyl 4-[2-(aminomethyl)piperidin-1-yl]sulfonyl-3-methoxybenzoate |
|---|---|
| PubChem CID | 120707972 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 4-[2-(aminomethyl)piperidin-1-yl]sulfonyl-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCCCC2CN)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-21-13-9-11(15(18)22-2)6-7-14(13)23(19,20)17-8-4-3-5-12(17)10-16/h6-7,9,12H,3-5,8,10,16H2,1-2H3 |
| InChIKey | BUOPQJQAGKXQEV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |