C13H16BrNO5S — CID 106773970
4-bromo-3-methyl-5-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid (PubChem CID 106773970) has the molecular formula C13H16BrNO5S and a molecular weight of 378.24 g/mol. Its IUPAC name is 4-bromo-3-methyl-5-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid.
| Compound Name | 4-bromo-3-methyl-5-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 106773970 |
| Molecular Formula | C13H16BrNO5S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 4-bromo-3-methyl-5-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)N2CCOC[C@H]2C)c1Br |
| InChI | InChI=1S/C13H16BrNO5S/c1-8-5-10(13(16)17)6-11(12(8)14)21(18,19)15-3-4-20-7-9(15)2/h5-6,9H,3-4,7H2,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | ZMIKTIHMSPOLRR-SECBINFHSA-N |
| XLogP | 1.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |