C11H14FN3O4S — CID 83094650
4-(2-amino-3-fluorophenyl)sulfonylmorpholine-3-carboxamide (PubChem CID 83094650) has the molecular formula C11H14FN3O4S and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-(2-amino-3-fluorophenyl)sulfonylmorpholine-3-carboxamide.
| Compound Name | 4-(2-amino-3-fluorophenyl)sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83094650 |
| Molecular Formula | C11H14FN3O4S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(2-amino-3-fluorophenyl)sulfonylmorpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1S(=O)(=O)c1cccc(F)c1N |
| InChI | InChI=1S/C11H14FN3O4S/c12-7-2-1-3-9(10(7)13)20(17,18)15-4-5-19-6-8(15)11(14)16/h1-3,8H,4-6,13H2,(H2,14,16) |
| InChIKey | ZOCBVXMHDHIPLZ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|