C11H13FN2O3S2 — CID 75443822
4-(2-fluorophenyl)sulfonylthiomorpholine-3-carboxamide (PubChem CID 75443822) has the molecular formula C11H13FN2O3S2 and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfonylthiomorpholine-3-carboxamide.
| Compound Name | 4-(2-fluorophenyl)sulfonylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 75443822 |
| Molecular Formula | C11H13FN2O3S2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-(2-fluorophenyl)sulfonylthiomorpholine-3-carboxamide |
| SMILES | NC(=O)C1CSCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C11H13FN2O3S2/c12-8-3-1-2-4-10(8)19(16,17)14-5-6-18-7-9(14)11(13)15/h1-4,9H,5-7H2,(H2,13,15) |
| InChIKey | PTDOYEUOMVGEDT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |