C11H11F2NO4S2 — CID 71419679
(3R)-4-(2,4-difluorophenyl)sulfonylthiomorpholine-3-carboxylic acid (PubChem CID 71419679) has the molecular formula C11H11F2NO4S2 and a molecular weight of 323.34 g/mol. Its IUPAC name is (3R)-4-(2,4-difluorophenyl)sulfonylthiomorpholine-3-carboxylic acid.
| Compound Name | (3R)-4-(2,4-difluorophenyl)sulfonylthiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 71419679 |
| Molecular Formula | C11H11F2NO4S2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | (3R)-4-(2,4-difluorophenyl)sulfonylthiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCCN1S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO4S2/c12-7-1-2-10(8(13)5-7)20(17,18)14-3-4-19-6-9(14)11(15)16/h1-2,5,9H,3-4,6H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | MGWGJCMYWDPMLJ-VIFPVBQESA-N |
| XLogP | 1.16 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |