C11H11ClFNO4S2 — CID 78980358
4-(4-chloro-2-fluorophenyl)sulfonylthiomorpholine-3-carboxylic acid (PubChem CID 78980358) has the molecular formula C11H11ClFNO4S2 and a molecular weight of 339.80 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)sulfonylthiomorpholine-3-carboxylic acid.
| Compound Name | 4-(4-chloro-2-fluorophenyl)sulfonylthiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78980358 |
| Molecular Formula | C11H11ClFNO4S2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)sulfonylthiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H11ClFNO4S2/c12-7-1-2-10(8(13)5-7)20(17,18)14-3-4-19-6-9(14)11(15)16/h1-2,5,9H,3-4,6H2,(H,15,16) |
| InChIKey | XZHFMHLIOIOKSF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |