C10H11F2NO2S2 — CID 122331633
3-(2,4-difluorophenyl)sulfonyl-2-methyl-1,3-thiazolidine (PubChem CID 122331633) has the molecular formula C10H11F2NO2S2 and a molecular weight of 279.33 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfonyl-2-methyl-1,3-thiazolidine.
| Compound Name | 3-(2,4-difluorophenyl)sulfonyl-2-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 122331633 |
| Molecular Formula | C10H11F2NO2S2 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfonyl-2-methyl-1,3-thiazolidine |
| SMILES | CC1SCCN1S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2NO2S2/c1-7-13(4-5-16-7)17(14,15)10-3-2-8(11)6-9(10)12/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | FZZBWDRTVNQMHK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |