C11H15NO2S2 — CID 852148
(2S)-2-methyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 852148) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (2S)-2-methyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2S)-2-methyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 852148 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (2S)-2-methyl-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCS[C@H]2C)cc1 |
| InChI | InChI=1S/C11H15NO2S2/c1-9-3-5-11(6-4-9)16(13,14)12-7-8-15-10(12)2/h3-6,10H,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | JKXSNTDYXVPUIL-JTQLQIEISA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |