C12H19NO3S2 — CID 88666389
2,3-dimethyl-1,3-thiazolidine;4-methylbenzenesulfonic acid (PubChem CID 88666389) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2,3-dimethyl-1,3-thiazolidine;4-methylbenzenesulfonic acid.
| Compound Name | 2,3-dimethyl-1,3-thiazolidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88666389 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2,3-dimethyl-1,3-thiazolidine;4-methylbenzenesulfonic acid |
| SMILES | CC1SCCN1C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C5H11NS/c1-6-2-4-7(5-3-6)11(8,9)10;1-5-6(2)3-4-7-5/h2-5H,1H3,(H,8,9,10);5H,3-4H2,1-2H3 |
| InChIKey | MTQOTPADUWTWHT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|