C12H13F3N2O3S — CID 60519923
1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 60519923) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60519923 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)8-4-1-2-6-10(8)21(19,20)17-7-3-5-9(17)11(16)18/h1-2,4,6,9H,3,5,7H2,(H2,16,18) |
| InChIKey | REQNVTMKKDCVPK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |