C12H15F3N2O2S — CID 43123375
1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine (PubChem CID 43123375) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.32 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine |
|---|---|
| PubChem CID | 43123375 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]sulfonylpiperidin-2-amine |
| SMILES | NC1CCCCN1S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2S/c13-12(14,15)9-5-1-2-6-10(9)20(18,19)17-8-4-3-7-11(17)16/h1-2,5-6,11H,3-4,7-8,16H2 |
| InChIKey | RXXQCXMVNGYDFR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |